cas: 218594-15-1 — see every product listed under this CAS number, including other names
tert-Butyl (6-bromopyridin-3-yl)carbamate 95% (CAS 218594-15-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A121583-250mg |
| cas | 218594-15-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 120.06 Pln | |
| Ambeed | 1g | 136.75 Pln | |
| Ambeed | 5g | 281.38 Pln | |
| Ambeed | 10g | 420.44 Pln | |
| Ambeed | 25g | 932.19 Pln | |
| Ambeed | 100g | 3424.19 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A121583 |
Tert-butyl N-(6-bromo-3-pyridinyl)carbamate (CAS 218594-15-1) is a chemical compound with the molecular formula C10H13BrN2O2 and a molecular weight of 273.13 g/mol. IUPAC name: tert-butyl N-(6-bromo-3-pyridinyl)carbamate. InChIKey: LSFAQGJWQMNXLP-UHFFFAOYSA-N.
| Molecular formula | C10H13BrN2O2 |
|---|---|
| Molecular weight | 273.13 g/mol |
| IUPAC name | tert-butyl N-(6-bromo-3-pyridinyl)carbamate |
| InChIKey | LSFAQGJWQMNXLP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=CN=C(C=C1)Br |
Computed by PubChem (NCBI)