cas: 79069-15-1 — see every product listed under this CAS number, including other names
tert-Butyl (S)-(1-(benzyloxy)-3-hydroxypropan-2-yl)carbamate 97% (CAS 79069-15-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A202057-250mg |
| cas | 79069-15-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 159.00 Pln | |
| Ambeed | 1g | 253.56 Pln | |
| Ambeed | 5g | 570.62 Pln | |
| Ambeed | 25g | 1838.88 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A202057 |
Tert-butyl N-[(2S)-1-hydroxy-3-phenylmethoxypropan-2-yl]carbamate (CAS 79069-15-1) is a chemical compound with the molecular formula C15H23NO4 and a molecular weight of 281.35 g/mol. IUPAC name: tert-butyl N-[(2S)-1-hydroxy-3-phenylmethoxypropan-2-yl]carbamate. InChIKey: MSIDLARYVJJEQY-ZDUSSCGKSA-N.
| Molecular formula | C15H23NO4 |
|---|---|
| Molecular weight | 281.35 g/mol |
| IUPAC name | tert-butyl N-[(2S)-1-hydroxy-3-phenylmethoxypropan-2-yl]carbamate |
| InChIKey | MSIDLARYVJJEQY-ZDUSSCGKSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CO)COCC1=CC=CC=C1 |
Computed by PubChem (NCBI)