cas: 167938-56-9 — see every product listed under this CAS number, including other names
tert-Butyl (S)-(2-hydroxypropyl)carbamate 98% (CAS 167938-56-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A918594-1g |
| cas | 167938-56-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 203.50 Pln | |
| Ambeed | 25g | 565.06 Pln | |
| Ambeed | 100g | 1744.31 Pln | |
| Ambeed | 500g | 6772.81 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A918594 |
Tert-butyl N-[(2S)-2-hydroxypropyl]carbamate (CAS 167938-56-9) is a chemical compound with the molecular formula C8H17NO3 and a molecular weight of 175.23 g/mol. IUPAC name: tert-butyl N-[(2S)-2-hydroxypropyl]carbamate. InChIKey: YNJCFDAODGKHAV-LURJTMIESA-N.
| Molecular formula | C8H17NO3 |
|---|---|
| Molecular weight | 175.23 g/mol |
| IUPAC name | tert-butyl N-[(2S)-2-hydroxypropyl]carbamate |
| InChIKey | YNJCFDAODGKHAV-LURJTMIESA-N |
| SMILES | C[C@@H](CNC(=O)OC(C)(C)C)O |
Computed by PubChem (NCBI)