cas: 2126088-17-1 — see every product listed under this CAS number, including other names
tert-Butyl (S)-(azetidin-2-ylmethyl)carbamate hydrochloride 95% (CAS 2126088-17-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A986780-100mg |
| cas | 2126088-17-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 487.19 Pln | |
| Ambeed | 250mg | 576.19 Pln | |
| Ambeed | 1g | 1260.38 Pln | |
| Ambeed | 5g | 4976.12 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A986780 |
Tert-butyl N-[[(2S)-azetidin-2-yl]methyl]carbamate;hydrochloride (CAS 2126088-17-1) is a chemical compound with the molecular formula C9H19ClN2O2 and a molecular weight of 222.71 g/mol. IUPAC name: tert-butyl N-[[(2S)-azetidin-2-yl]methyl]carbamate;hydrochloride. InChIKey: ZVMLJKVCRIASFQ-FJXQXJEOSA-N.
| Molecular formula | C9H19ClN2O2 |
|---|---|
| Molecular weight | 222.71 g/mol |
| IUPAC name | tert-butyl N-[[(2S)-azetidin-2-yl]methyl]carbamate;hydrochloride |
| InChIKey | ZVMLJKVCRIASFQ-FJXQXJEOSA-N |
| SMILES | CC(C)(C)OC(=O)NC[C@@H]1CCN1.Cl |
Computed by PubChem (NCBI)