cas: 185693-12-3 — see every product listed under this CAS number, including other names
tert-Butyl (octahydrocyclopenta[c]pyrrol-4-yl)carbamate 95% (CAS 185693-12-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A638187-100mg |
| cas | 185693-12-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 865.44 Pln | |
| Ambeed | 250mg | 1666.44 Pln | |
| Ambeed | 1g | 4364.25 Pln | |
| Ambeed | 5g | 14343.38 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A638187 |
Tert-butyl N-(1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-4-yl)carbamate (CAS 185693-12-3) is a chemical compound with the molecular formula C12H22N2O2 and a molecular weight of 226.32 g/mol. IUPAC name: tert-butyl N-(1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-4-yl)carbamate. InChIKey: HODGRZURVLFVKM-UHFFFAOYSA-N.
| Molecular formula | C12H22N2O2 |
|---|---|
| Molecular weight | 226.32 g/mol |
| IUPAC name | tert-butyl N-(1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-4-yl)carbamate |
| InChIKey | HODGRZURVLFVKM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1CCC2C1CNC2 |
Computed by PubChem (NCBI)