cas: 185693-12-3 — see every product listed under this CAS number, including other names
tert-Butyl (octahydrocyclopenta[c]pyrrol-4-yl)carbamate, 95%, 95% (CAS 185693-12-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11AORQ-100mg |
| cas | 185693-12-3 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 712.40 Pln | |
| Chemat | 250mg | 1360.40 Pln | |
| Chemat | 1g | 3592.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl N-(1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-4-yl)carbamate (CAS 185693-12-3) is a chemical compound with the molecular formula C12H22N2O2 and a molecular weight of 226.32 g/mol. IUPAC name: tert-butyl N-(1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-4-yl)carbamate. InChIKey: HODGRZURVLFVKM-UHFFFAOYSA-N.
| Molecular formula | C12H22N2O2 |
|---|---|
| Molecular weight | 226.32 g/mol |
| IUPAC name | tert-butyl N-(1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-4-yl)carbamate |
| InChIKey | HODGRZURVLFVKM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1CCC2C1CNC2 |
Computed by PubChem (NCBI)