cas: 1188263-69-5 — see every product listed under this CAS number, including other names
tert-Butyl (pyrrolidin-3-ylmethyl)carbamate hydrochloride 98% (CAS 1188263-69-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A411880-250mg |
| cas | 1188263-69-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 186.81 Pln | |
| Ambeed | 1g | 337.00 Pln | |
| Ambeed | 5g | 904.38 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A411880 |
Tert-butyl N-(pyrrolidin-3-ylmethyl)carbamate;hydrochloride (CAS 1188263-69-5) is a chemical compound with the molecular formula C10H21ClN2O2 and a molecular weight of 236.74 g/mol. IUPAC name: tert-butyl N-(pyrrolidin-3-ylmethyl)carbamate;hydrochloride. InChIKey: WEUDEPABMRKFFT-UHFFFAOYSA-N.
| Molecular formula | C10H21ClN2O2 |
|---|---|
| Molecular weight | 236.74 g/mol |
| IUPAC name | tert-butyl N-(pyrrolidin-3-ylmethyl)carbamate;hydrochloride |
| InChIKey | WEUDEPABMRKFFT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCC1CCNC1.Cl |
Computed by PubChem (NCBI)