cas: 1188263-69-5 — see every product listed under this CAS number, including other names
tert-Butyl (pyrrolidin-3-ylmethyl)carbamate hydrochloride, 97%, 97% (CAS 1188263-69-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch119Y9M-100mg |
| cas | 1188263-69-5 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 107.60 Pln | |
| Chemat | 250mg | 136.40 Pln | |
| Chemat | 500mg | 194.00 Pln | |
| Chemat | 1g | 213.20 Pln | |
| Chemat | 5g | 674.00 Pln | |
| Chemat | 10g | 1293.20 Pln | |
| Chemat | 25g | 3136.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl N-(pyrrolidin-3-ylmethyl)carbamate;hydrochloride (CAS 1188263-69-5) is a chemical compound with the molecular formula C10H21ClN2O2 and a molecular weight of 236.74 g/mol. IUPAC name: tert-butyl N-(pyrrolidin-3-ylmethyl)carbamate;hydrochloride. InChIKey: WEUDEPABMRKFFT-UHFFFAOYSA-N.
| Molecular formula | C10H21ClN2O2 |
|---|---|
| Molecular weight | 236.74 g/mol |
| IUPAC name | tert-butyl N-(pyrrolidin-3-ylmethyl)carbamate;hydrochloride |
| InChIKey | WEUDEPABMRKFFT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCC1CCNC1.Cl |
Computed by PubChem (NCBI)