cas: 883554-11-8 — see every product listed under this CAS number, including other names
tert-Butyl 2,5,8,11-tetraoxatetradecan-14-oate, 98%, 98% (CAS 883554-11-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 500mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IF3H-100mg |
| cas | 883554-11-8 |
| size | 100mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 107.60 Pln | |
| Chemat | 250mg | 165.20 Pln | |
| Chemat | 1g | 453.20 Pln | |
| Chemat | 5g | 1682.00 Pln | |
| Chemat | 10g | 2819.60 Pln | |
| Chemat | 500mg | 280.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]propanoate (CAS 883554-11-8) is a chemical compound with the molecular formula C14H28O6 and a molecular weight of 292.37 g/mol. IUPAC name: tert-butyl 3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]propanoate. InChIKey: JUINYDFUOXIVCX-UHFFFAOYSA-N.
| Molecular formula | C14H28O6 |
|---|---|
| Molecular weight | 292.37 g/mol |
| IUPAC name | tert-butyl 3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]propanoate |
| InChIKey | JUINYDFUOXIVCX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CCOCCOCCOCCOC |
Computed by PubChem (NCBI)