cas: 1279856-08-4 — see every product listed under this CAS number, including other names
tert-Butyl 2,7-diazaspiro[4.5]decane-7-carboxylate hydrochloride, 97%, 97% (CAS 1279856-08-4) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111XN9-1g |
| cas | 1279856-08-4 |
| size | 1g |
| availability | 4g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 1278.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 2,7-diazaspiro[4.5]decane-7-carboxylate;hydrochloride (CAS 1279856-08-4) is a chemical compound with the molecular formula C13H25ClN2O2 and a molecular weight of 276.80 g/mol. IUPAC name: tert-butyl 2,7-diazaspiro[4.5]decane-7-carboxylate;hydrochloride. InChIKey: DSLZXSCWMHHHKN-UHFFFAOYSA-N.
| Molecular formula | C13H25ClN2O2 |
|---|---|
| Molecular weight | 276.80 g/mol |
| IUPAC name | tert-butyl 2,7-diazaspiro[4.5]decane-7-carboxylate;hydrochloride |
| InChIKey | DSLZXSCWMHHHKN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCC2(C1)CCNC2.Cl |
Computed by PubChem (NCBI)