cas: 125971-94-0 — see every product listed under this CAS number, including other names
tert-Butyl 2-((4R,6R)-6-(cyanomethyl)-2,2-dimethyl-1,3-dioxan-4-yl)acetate, 95%, 95% (CAS 125971-94-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111QLY-1g |
| cas | 125971-94-0 |
| size | 1g |
| availability | 500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 93.20 Pln | |
| Chemat | 10g | 122.00 Pln | |
| Chemat | 25g | 165.20 Pln | |
| Chemat | 100g | 352.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 2-[(4R,6R)-6-(cyanomethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetate (CAS 125971-94-0) is a chemical compound with the molecular formula C14H23NO4 and a molecular weight of 269.34 g/mol. IUPAC name: tert-butyl 2-[(4R,6R)-6-(cyanomethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetate. InChIKey: DPNRMEJBKMQHMC-GHMZBOCLSA-N.
| Molecular formula | C14H23NO4 |
|---|---|
| Molecular weight | 269.34 g/mol |
| IUPAC name | tert-butyl 2-[(4R,6R)-6-(cyanomethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetate |
| InChIKey | DPNRMEJBKMQHMC-GHMZBOCLSA-N |
| SMILES | CC1(O[C@@H](C[C@@H](O1)CC(=O)OC(C)(C)C)CC#N)C |
Computed by PubChem (NCBI)