cas: 276884-77-6 — see every product listed under this CAS number, including other names
tert-Butyl 2-(4-formylphenoxy)acetate, 98%, 98% (CAS 276884-77-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113UG0-100mg |
| cas | 276884-77-6 |
| size | 100mg |
| availability | 29.9g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 136.40 Pln | |
| Chemat | 250mg | 198.80 Pln | |
| Chemat | 1g | 462.80 Pln | |
| Chemat | 5g | 1566.80 Pln | |
| Chemat | 25g | 5522.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 2-(4-formylphenoxy)acetate (CAS 276884-77-6) is a chemical compound with the molecular formula C13H16O4 and a molecular weight of 236.26 g/mol. IUPAC name: tert-butyl 2-(4-formylphenoxy)acetate. InChIKey: TZONEPGXYVZUKR-UHFFFAOYSA-N.
| Molecular formula | C13H16O4 |
|---|---|
| Molecular weight | 236.26 g/mol |
| IUPAC name | tert-butyl 2-(4-formylphenoxy)acetate |
| InChIKey | TZONEPGXYVZUKR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)COC1=CC=C(C=C1)C=O |
Computed by PubChem (NCBI)