tert-Butyl 2-(piperidin-4-yl)acetate oxalate, 95%
cas: 1360438-13-6 — see every product listed under this CAS number, including other names
tert-Butyl 2-(piperidin-4-yl)acetate oxalate, 95% (CAS 1360438-13-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem, Ambeed, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F552117-100MG |
| cas | 1360438-13-6 |
| size | 100mg |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 133.30 Pln | |
| Fluorochem | 250mg | 174.96 Pln | |
| Ambeed | 100mg | 136.75 Pln | |
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 337.00 Pln | |
| Ambeed | 5g | 1366.06 Pln | |
| Ambeed | 10g | 2345.06 Pln | |
| Chemat | 100mg | 93.20 Pln | |
| Chemat | 250mg | 122.00 Pln | |
| Chemat | 1g | 213.20 Pln | |
| Chemat | 5g | 770.00 Pln |
properties
| purity | 95% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
Tert-butyl 2-piperidin-4-ylacetate;oxalic acid (CAS 1360438-13-6) is a chemical compound with the molecular formula C13H23NO6 and a molecular weight of 289.32 g/mol. IUPAC name: tert-butyl 2-piperidin-4-ylacetate;oxalic acid. InChIKey: PXCVMBFZUZHSPU-UHFFFAOYSA-N.
| Molecular formula | C13H23NO6 |
|---|---|
| Molecular weight | 289.32 g/mol |
| IUPAC name | tert-butyl 2-piperidin-4-ylacetate;oxalic acid |
| InChIKey | PXCVMBFZUZHSPU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CC1CCNCC1.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)