cas: 168629-64-9 — see every product listed under this CAS number, including other names
tert-Butyl 2-bromonicotinate, 97% (CAS 168629-64-9) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 100mg, 250mg, 500mg, 1g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A277537-5g |
| cas | 168629-64-9 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 6475.84 Pln | |
| AmBeed | 10g | 10752.91 Pln | |
| Fluorochem | 100mg | 664.37 Pln | |
| Fluorochem | 250mg | 862.21 Pln | |
| Fluorochem | 500mg | 1382.86 Pln | |
| Fluorochem | 1g | 2044.09 Pln | |
| Fluorochem | 5g | 5985.41 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
Tert-butyl 2-bromopyridine-3-carboxylate (CAS 168629-64-9) is a chemical compound with the molecular formula C10H12BrNO2 and a molecular weight of 258.11 g/mol. IUPAC name: tert-butyl 2-bromopyridine-3-carboxylate. InChIKey: OUJNDKUAPNBGCN-UHFFFAOYSA-N.
| Molecular formula | C10H12BrNO2 |
|---|---|
| Molecular weight | 258.11 g/mol |
| IUPAC name | tert-butyl 2-bromopyridine-3-carboxylate |
| InChIKey | OUJNDKUAPNBGCN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=C(N=CC=C1)Br |
Computed by PubChem (NCBI)