cas: 1251015-63-0 — see every product listed under this CAS number, including other names
tert-Butyl 3,9-diazabicyclo[4.2.1]nonane-9-carboxylate 97% (CAS 1251015-63-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A666469-100mg |
| cas | 1251015-63-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 559.50 Pln | |
| Ambeed | 250mg | 882.12 Pln | |
| Ambeed | 1g | 1716.50 Pln | |
| Ambeed | 5g | 5827.19 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A666469 |
Tert-butyl 3,9-diazabicyclo[4.2.1]nonane-9-carboxylate (CAS 1251015-63-0) is a chemical compound with the molecular formula C12H22N2O2 and a molecular weight of 226.32 g/mol. IUPAC name: tert-butyl 3,9-diazabicyclo[4.2.1]nonane-9-carboxylate. InChIKey: IDJDDPDWYRVJPF-UHFFFAOYSA-N.
| Molecular formula | C12H22N2O2 |
|---|---|
| Molecular weight | 226.32 g/mol |
| IUPAC name | tert-butyl 3,9-diazabicyclo[4.2.1]nonane-9-carboxylate |
| InChIKey | IDJDDPDWYRVJPF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C2CCC1CNCC2 |
Computed by PubChem (NCBI)