cas: 889955-52-6 — see every product listed under this CAS number, including other names
tert-Butyl 3-(3-ethoxy-3-oxopropanoyl)pyrrolidine-1-carboxylate 98% (CAS 889955-52-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A539237-100mg |
| cas | 889955-52-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 542.81 Pln | |
| Ambeed | 250mg | 776.44 Pln | |
| Ambeed | 1g | 1744.31 Pln | |
| Ambeed | 5g | 4364.25 Pln | |
| Ambeed | 10g | 7612.75 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A539237 |
Tert-butyl 3-(3-ethoxy-3-oxopropanoyl)pyrrolidine-1-carboxylate (CAS 889955-52-6) is a chemical compound with the molecular formula C14H23NO5 and a molecular weight of 285.34 g/mol. IUPAC name: tert-butyl 3-(3-ethoxy-3-oxopropanoyl)pyrrolidine-1-carboxylate. InChIKey: XJQOTLQCHLIYFO-UHFFFAOYSA-N.
| Molecular formula | C14H23NO5 |
|---|---|
| Molecular weight | 285.34 g/mol |
| IUPAC name | tert-butyl 3-(3-ethoxy-3-oxopropanoyl)pyrrolidine-1-carboxylate |
| InChIKey | XJQOTLQCHLIYFO-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC(=O)C1CCN(C1)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)