cas: 218772-62-4 — see every product listed under this CAS number, including other names
tert-Butyl 3-(cyanomethyl)-1H-indole-1-carboxylate, 98% (CAS 218772-62-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 100mg, 250mg. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A568906-1g |
| cas | 218772-62-4 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 3155.74 Pln | |
| Fluorochem | 100mg | 659.16 Pln | |
| Fluorochem | 250mg | 1028.82 Pln | |
| Fluorochem | 1g | 1976.41 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
Tert-butyl 3-(cyanomethyl)indole-1-carboxylate (CAS 218772-62-4) is a chemical compound with the molecular formula C15H16N2O2 and a molecular weight of 256.30 g/mol. IUPAC name: tert-butyl 3-(cyanomethyl)indole-1-carboxylate. InChIKey: YCQLNYZZVFUWIZ-UHFFFAOYSA-N.
| Molecular formula | C15H16N2O2 |
|---|---|
| Molecular weight | 256.30 g/mol |
| IUPAC name | tert-butyl 3-(cyanomethyl)indole-1-carboxylate |
| InChIKey | YCQLNYZZVFUWIZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C=C(C2=CC=CC=C21)CC#N |
Computed by PubChem (NCBI)