cas: 479622-36-1 — see every product listed under this CAS number, including other names
tert-Butyl 3-(iodomethyl)pyrrolidine-1-carboxylate 97% (CAS 479622-36-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A841075-1g |
| cas | 479622-36-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 325.88 Pln | |
| Ambeed | 5g | 854.31 Pln | |
| Ambeed | 10g | 1560.75 Pln | |
| Ambeed | 25g | 3162.75 Pln | |
| Ambeed | 100g | 10310.56 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A841075 |
Tert-butyl 3-(iodomethyl)pyrrolidine-1-carboxylate (CAS 479622-36-1) is a chemical compound with the molecular formula C10H18INO2 and a molecular weight of 311.16 g/mol. IUPAC name: tert-butyl 3-(iodomethyl)pyrrolidine-1-carboxylate. InChIKey: DNUFVBGZKFHSDQ-UHFFFAOYSA-N.
| Molecular formula | C10H18INO2 |
|---|---|
| Molecular weight | 311.16 g/mol |
| IUPAC name | tert-butyl 3-(iodomethyl)pyrrolidine-1-carboxylate |
| InChIKey | DNUFVBGZKFHSDQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(C1)CI |
Computed by PubChem (NCBI)