cas: 1280210-79-8 — see every product listed under this CAS number, including other names
tert-Butyl 4,6-dihydropyrrolo[3,4-c]pyrazole-5(2H)-carboxylate 97% (CAS 1280210-79-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A122289-100mg |
| cas | 1280210-79-8 |
| size | 100mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 175.69 Pln | |
| Ambeed | 250mg | 197.94 Pln | |
| Ambeed | 1g | 220.19 Pln | |
| Ambeed | 5g | 281.38 Pln | |
| Ambeed | 25g | 804.25 Pln | |
| Ambeed | 100g | 2689.94 Pln | |
| Ambeed | 500g | 10544.19 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A122289 |
Tert-butyl 4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole-5-carboxylate (CAS 1280210-79-8) is a chemical compound with the molecular formula C10H15N3O2 and a molecular weight of 209.24 g/mol. IUPAC name: tert-butyl 4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole-5-carboxylate. InChIKey: IBUNCTVDGYIKAP-UHFFFAOYSA-N.
| Molecular formula | C10H15N3O2 |
|---|---|
| Molecular weight | 209.24 g/mol |
| IUPAC name | tert-butyl 4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole-5-carboxylate |
| InChIKey | IBUNCTVDGYIKAP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2=C(C1)NN=C2 |
Computed by PubChem (NCBI)