cas: 162045-30-9 — see every product listed under this CAS number, including other names
tert-Butyl 4-(2-oxo-2,4-dihydro-1H-benzo[d][1,3]oxazin-1-yl)piperidine-1-carboxylate, 97% (CAS 162045-30-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F602170-100MG |
| cas | 162045-30-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 482.14 Pln | |
| Fluorochem | 250mg | 716.43 Pln | |
| Fluorochem | 1g | 846.59 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl 4-(2-oxo-4H-3,1-benzoxazin-1-yl)piperidine-1-carboxylate (CAS 162045-30-9) is a chemical compound with the molecular formula C18H24N2O4 and a molecular weight of 332.4 g/mol. IUPAC name: tert-butyl 4-(2-oxo-4H-3,1-benzoxazin-1-yl)piperidine-1-carboxylate. InChIKey: XJVWIJJRQGZWEZ-UHFFFAOYSA-N.
| Molecular formula | C18H24N2O4 |
|---|---|
| Molecular weight | 332.4 g/mol |
| IUPAC name | tert-butyl 4-(2-oxo-4H-3,1-benzoxazin-1-yl)piperidine-1-carboxylate |
| InChIKey | XJVWIJJRQGZWEZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)N2C3=CC=CC=C3COC2=O |
Computed by PubChem (NCBI)