cas: 77290-31-4 — see every product listed under this CAS number, including other names
tert-Butyl 4-(cyanomethyl)piperazine-1-carboxylate 96% (CAS 77290-31-4) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A697516-5g |
| cas | 77290-31-4 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 186.81 Pln | |
| Ambeed | 25g | 481.62 Pln |
| purity | 96% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A697516 |
Tert-butyl 4-(cyanomethyl)piperazine-1-carboxylate (CAS 77290-31-4) is a chemical compound with the molecular formula C11H19N3O2 and a molecular weight of 225.29 g/mol. IUPAC name: tert-butyl 4-(cyanomethyl)piperazine-1-carboxylate. InChIKey: OJUKCGDZZNLDPC-UHFFFAOYSA-N.
| Molecular formula | C11H19N3O2 |
|---|---|
| Molecular weight | 225.29 g/mol |
| IUPAC name | tert-butyl 4-(cyanomethyl)piperazine-1-carboxylate |
| InChIKey | OJUKCGDZZNLDPC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC1)CC#N |
Computed by PubChem (NCBI)