cas: 658683-18-2 — see every product listed under this CAS number, including other names
tert-Butyl 4-bromo-1-oxoisoindoline-2-carboxylate, 96% (CAS 658683-18-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F608136-100MG |
| cas | 658683-18-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 190.58 Pln | |
| Fluorochem | 250mg | 279.09 Pln | |
| Fluorochem | 1g | 419.66 Pln | |
| Fluorochem | 5g | 1893.10 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl 7-bromo-3-oxo-1H-isoindole-2-carboxylate (CAS 658683-18-2) is a chemical compound with the molecular formula C13H14BrNO3 and a molecular weight of 312.16 g/mol. IUPAC name: tert-butyl 7-bromo-3-oxo-1H-isoindole-2-carboxylate. InChIKey: YSYDNTZMVORVFE-UHFFFAOYSA-N.
| Molecular formula | C13H14BrNO3 |
|---|---|
| Molecular weight | 312.16 g/mol |
| IUPAC name | tert-butyl 7-bromo-3-oxo-1H-isoindole-2-carboxylate |
| InChIKey | YSYDNTZMVORVFE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2=C(C1=O)C=CC=C2Br |
Computed by PubChem (NCBI)