cas: 885272-46-8 — see every product listed under this CAS number, including other names
tert-Butyl 4-bromoindoline-1-carboxylate, 95% (CAS 885272-46-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F321533-1G |
| cas | 885272-46-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 200.99 Pln | |
| Fluorochem | 5g | 784.12 Pln | |
| Fluorochem | 10g | 1507.82 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
Tert-butyl 4-bromo-2,3-dihydroindole-1-carboxylate (CAS 885272-46-8) is a chemical compound with the molecular formula C13H16BrNO2 and a molecular weight of 298.18 g/mol. IUPAC name: tert-butyl 4-bromo-2,3-dihydroindole-1-carboxylate. InChIKey: DUZIJTYKDFFQDJ-UHFFFAOYSA-N.
| Molecular formula | C13H16BrNO2 |
|---|---|
| Molecular weight | 298.18 g/mol |
| IUPAC name | tert-butyl 4-bromo-2,3-dihydroindole-1-carboxylate |
| InChIKey | DUZIJTYKDFFQDJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2=C1C=CC=C2Br |
Computed by PubChem (NCBI)