cas: 182352-48-3 — see every product listed under this CAS number, including other names
tert-Butyl 4-hydroxy-2-oxo-2,5-dihydro-1H-pyrrole-1-carboxylate, 98%, 98% (CAS 182352-48-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1134PI-100mg |
| cas | 182352-48-3 |
| size | 100mg |
| availability | 500g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 117.20 Pln | |
| Chemat | 250mg | 194.00 Pln | |
| Chemat | 1g | 338.00 Pln | |
| Chemat | 5g | 890.00 Pln | |
| Chemat | 10g | 1442.00 Pln | |
| Chemat | 25g | 2334.80 Pln | |
| Chemat | 50g | 3851.60 Pln | |
| Chemat | 100g | 6266.00 Pln | |
| Chemat | 250g | 14819.60 Pln | |
| Chemat | 500g | 25968.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 3-hydroxy-5-oxo-2H-pyrrole-1-carboxylate (CAS 182352-48-3) is a chemical compound with the molecular formula C9H13NO4 and a molecular weight of 199.20 g/mol. IUPAC name: tert-butyl 3-hydroxy-5-oxo-2H-pyrrole-1-carboxylate. InChIKey: FUOLLMGMLYOWGP-UHFFFAOYSA-N.
| Molecular formula | C9H13NO4 |
|---|---|
| Molecular weight | 199.20 g/mol |
| IUPAC name | tert-butyl 3-hydroxy-5-oxo-2H-pyrrole-1-carboxylate |
| InChIKey | FUOLLMGMLYOWGP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(=CC1=O)O |
Computed by PubChem (NCBI)