cas: 879686-42-7 — see every product listed under this CAS number, including other names
tert-Butyl 4-oxohexahydrocyclopenta[c]pyrrole-2(1H)-carboxylate 98% (CAS 879686-42-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A190228-100mg |
| cas | 879686-42-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 331.44 Pln | |
| Ambeed | 250mg | 381.50 Pln | |
| Ambeed | 1g | 854.31 Pln | |
| Ambeed | 5g | 2584.25 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A190228 |
Tert-butyl 4-oxo-1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrole-2-carboxylate (CAS 879686-42-7) is a chemical compound with the molecular formula C12H19NO3 and a molecular weight of 225.28 g/mol. IUPAC name: tert-butyl 4-oxo-1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrole-2-carboxylate. InChIKey: MZQZNAQWIOWKSR-UHFFFAOYSA-N.
| Molecular formula | C12H19NO3 |
|---|---|
| Molecular weight | 225.28 g/mol |
| IUPAC name | tert-butyl 4-oxo-1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrole-2-carboxylate |
| InChIKey | MZQZNAQWIOWKSR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2CCC(=O)C2C1 |
Computed by PubChem (NCBI)