cas: 879686-42-7 — see every product listed under this CAS number, including other names
tert-Butyl 4-oxohexahydrocyclopenta[c]pyrrole-2(1H)-carboxylate, 98%, 98% (CAS 879686-42-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11H1ZI-100mg |
| cas | 879686-42-7 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 256.40 Pln | |
| Chemat | 250mg | 362.00 Pln | |
| Chemat | 500mg | 635.60 Pln | |
| Chemat | 1g | 712.40 Pln | |
| Chemat | 5g | 2594.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 4-oxo-1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrole-2-carboxylate (CAS 879686-42-7) is a chemical compound with the molecular formula C12H19NO3 and a molecular weight of 225.28 g/mol. IUPAC name: tert-butyl 4-oxo-1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrole-2-carboxylate. InChIKey: MZQZNAQWIOWKSR-UHFFFAOYSA-N.
| Molecular formula | C12H19NO3 |
|---|---|
| Molecular weight | 225.28 g/mol |
| IUPAC name | tert-butyl 4-oxo-1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrole-2-carboxylate |
| InChIKey | MZQZNAQWIOWKSR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2CCC(=O)C2C1 |
Computed by PubChem (NCBI)