cas: 886766-34-3 — see every product listed under this CAS number, including other names
tert-Butyl 5,8-diazaspiro[3.5]nonane-5-carboxylate, 97%, 97% (CAS 886766-34-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IFBX-100mg |
| cas | 886766-34-3 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 395.60 Pln | |
| Chemat | 250mg | 597.20 Pln | |
| Chemat | 500mg | 990.80 Pln | |
| Chemat | 1g | 1336.40 Pln | |
| Chemat | 5g | 5142.80 Pln | |
| Chemat | 10g | 9808.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 5,8-diazaspiro[3.5]nonane-5-carboxylate (CAS 886766-34-3) is a chemical compound with the molecular formula C12H22N2O2 and a molecular weight of 226.32 g/mol. IUPAC name: tert-butyl 5,8-diazaspiro[3.5]nonane-5-carboxylate. InChIKey: YZZOBJMUDHAXFE-UHFFFAOYSA-N.
| Molecular formula | C12H22N2O2 |
|---|---|
| Molecular weight | 226.32 g/mol |
| IUPAC name | tert-butyl 5,8-diazaspiro[3.5]nonane-5-carboxylate |
| InChIKey | YZZOBJMUDHAXFE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCNCC12CCC2 |
Computed by PubChem (NCBI)