tert-Butyl 5-aminopentanoate oxalate(1:x), 95%
cas: 660413-26-3 — see every product listed under this CAS number, including other names
tert-Butyl 5-aminopentanoate oxalate(1:x), 95% (CAS 660413-26-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A2258149-250mg |
| cas | 660413-26-3 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 309.19 Pln | |
| Ambeed | 1g | 709.69 Pln | |
| Ambeed | 5g | 1994.62 Pln | |
| Chemat | 100mg | 203.60 Pln | |
| Chemat | 250mg | 304.40 Pln | |
| Chemat | 1g | 707.60 Pln | |
| Chemat | 5g | 2003.60 Pln | |
| BLDpharm | 100mg | 219.95 Pln | |
| BLDpharm | 250mg | 325.47 Pln | |
| BLDpharm | 1g | 758.65 Pln | |
| BLDpharm | 5g | 2147.05 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
Tert-butyl 5-aminopentanoate;oxalic acid (CAS 660413-26-3) is a chemical compound with the molecular formula C11H21NO6 and a molecular weight of 263.29 g/mol. IUPAC name: tert-butyl 5-aminopentanoate;oxalic acid. InChIKey: ONEYSNZKNIVLPA-UHFFFAOYSA-N.
| Molecular formula | C11H21NO6 |
|---|---|
| Molecular weight | 263.29 g/mol |
| IUPAC name | tert-butyl 5-aminopentanoate;oxalic acid |
| InChIKey | ONEYSNZKNIVLPA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CCCCN.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)
Synonyms:
tert-Butyl 5-aminopentanoate oxalate(1:x), ONEYSNZKNIVLPA-UHFFFAOYSA-N, tert-butyl 5-aminopentanoate oxalate, tert-Butyl 5-Aminopentanoate xOxalate, tert-butyl 5-aminopentanoate;oxalic acid, tert-butyl 5-aminopentanoate oxalic acid salt, Pentanoic acid, 5-amino-, 1,1-dimethylethyl ester, ethanedioate (1:)