cas: 928653-80-9 — see every product listed under this CAS number, including other names
tert-Butyl 5-bromo-1H-pyrrolo[2,3-b]pyridine-1-carboxylate 98% (CAS 928653-80-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A579690-100mg |
| cas | 928653-80-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 203.50 Pln | |
| Ambeed | 250mg | 275.81 Pln | |
| Ambeed | 1g | 331.44 Pln | |
| Ambeed | 5g | 909.94 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A579690 |
Tert-butyl 5-bromopyrrolo[2,3-b]pyridine-1-carboxylate (CAS 928653-80-9) is a chemical compound with the molecular formula C12H13BrN2O2 and a molecular weight of 297.15 g/mol. IUPAC name: tert-butyl 5-bromopyrrolo[2,3-b]pyridine-1-carboxylate. InChIKey: IEJVSMXKNBLMND-UHFFFAOYSA-N.
| Molecular formula | C12H13BrN2O2 |
|---|---|
| Molecular weight | 297.15 g/mol |
| IUPAC name | tert-butyl 5-bromopyrrolo[2,3-b]pyridine-1-carboxylate |
| InChIKey | IEJVSMXKNBLMND-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C=CC2=CC(=CN=C21)Br |
Computed by PubChem (NCBI)