cas: 400727-63-1 — see every product listed under this CAS number, including other names
tert-Butyl 5-nitroisoindoline-2-carboxylate 95% (CAS 400727-63-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A912462-250mg |
| cas | 400727-63-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 159.00 Pln | |
| Ambeed | 1g | 270.25 Pln | |
| Ambeed | 5g | 893.25 Pln | |
| Ambeed | 25g | 3535.44 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A912462 |
Tert-butyl 5-nitro-1,3-dihydroisoindole-2-carboxylate (CAS 400727-63-1) is a chemical compound with the molecular formula C13H16N2O4 and a molecular weight of 264.28 g/mol. IUPAC name: tert-butyl 5-nitro-1,3-dihydroisoindole-2-carboxylate. InChIKey: QKGLAXAXISGACQ-UHFFFAOYSA-N.
| Molecular formula | C13H16N2O4 |
|---|---|
| Molecular weight | 264.28 g/mol |
| IUPAC name | tert-butyl 5-nitro-1,3-dihydroisoindole-2-carboxylate |
| InChIKey | QKGLAXAXISGACQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2=C(C1)C=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)