CAS 341013-60-3 is the registry number for 2,6-Dimethyl-4-(4-nitrobenzoyl)morpholine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
(2,6-dimethylmorpholin-4-yl)-(4-nitrophenyl)methanone (CAS 341013-60-3) is a chemical compound with the molecular formula C13H16N2O4 and a molecular weight of 264.28 g/mol. IUPAC name: (2,6-dimethylmorpholin-4-yl)-(4-nitrophenyl)methanone. InChIKey: HWYYUVZSWZFHEI-UHFFFAOYSA-N.
| Molecular formula | C13H16N2O4 |
|---|---|
| Molecular weight | 264.28 g/mol |
| IUPAC name | (2,6-dimethylmorpholin-4-yl)-(4-nitrophenyl)methanone |
| InChIKey | HWYYUVZSWZFHEI-UHFFFAOYSA-N |
| SMILES | CC1CN(CC(O1)C)C(=O)C2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)