CAS 129488-25-1 is the registry number for tert-Butyl 5-nitro-2,3-dihydroindole-1-carboxylate, 96%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 25g, 100g.
Tert-butyl 5-nitro-2,3-dihydroindole-1-carboxylate (CAS 129488-25-1) is a chemical compound with the molecular formula C13H16N2O4 and a molecular weight of 264.28 g/mol. IUPAC name: tert-butyl 5-nitro-2,3-dihydroindole-1-carboxylate. InChIKey: XAHXDZHKYXQFKW-UHFFFAOYSA-N.
| Molecular formula | C13H16N2O4 |
|---|---|
| Molecular weight | 264.28 g/mol |
| IUPAC name | tert-butyl 5-nitro-2,3-dihydroindole-1-carboxylate |
| InChIKey | XAHXDZHKYXQFKW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2=C1C=CC(=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)