Products 380194-19-4
CAS 380194-19-4 appears in our catalog under these names: 4-(3-Methylpiperidin-1-yl)-3-nitrobenzoic acid, 4-(3-Methylpiperidin-1-yl)-3-nitrobenzoic acid, 95%, 4-(3-Methylpiperidin-1-yl)-3-nitrobenzoic acid, 97%. Offered by: Biosynth, Combi-blocks, AmBeed. Available pack sizes: 0,5g, 5g, 100mg, 10g, 250mg, 1g.
4-(3-methylpiperidin-1-yl)-3-nitrobenzoic acid (CAS 380194-19-4) is a chemical compound with the molecular formula C13H16N2O4 and a molecular weight of 264.28 g/mol. IUPAC name: 4-(3-methylpiperidin-1-yl)-3-nitrobenzoic acid. InChIKey: IXKFKPMYUCTQPG-UHFFFAOYSA-N.
| Molecular formula | C13H16N2O4 |
|---|---|
| Molecular weight | 264.28 g/mol |
| IUPAC name | 4-(3-methylpiperidin-1-yl)-3-nitrobenzoic acid |
| InChIKey | IXKFKPMYUCTQPG-UHFFFAOYSA-N |
| SMILES | CC1CCCN(C1)C2=C(C=C(C=C2)C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)