Products 312921-75-8

CAS 312921-75-8 is the registry number for 4-(4-Methylpiperidin-1-yl)-3-nitrobenzoic acid, 95%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

4-(4-methylpiperidin-1-yl)-3-nitrobenzoic acid (CAS 312921-75-8) is a chemical compound with the molecular formula C13H16N2O4 and a molecular weight of 264.28 g/mol. IUPAC name: 4-(4-methylpiperidin-1-yl)-3-nitrobenzoic acid. InChIKey: UMFDTTHDTBZAGN-UHFFFAOYSA-N.

Identity
Molecular formulaC13H16N2O4
Molecular weight264.28 g/mol
IUPAC name4-(4-methylpiperidin-1-yl)-3-nitrobenzoic acid
InChIKeyUMFDTTHDTBZAGN-UHFFFAOYSA-N
SMILESCC1CCN(CC1)C2=C(C=C(C=C2)C(=O)O)[N+](=O)[O-]

Computed by PubChem (NCBI)