CAS 312921-75-8 is the registry number for 4-(4-Methylpiperidin-1-yl)-3-nitrobenzoic acid, 95%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 1g, 5g.
4-(4-methylpiperidin-1-yl)-3-nitrobenzoic acid (CAS 312921-75-8) is a chemical compound with the molecular formula C13H16N2O4 and a molecular weight of 264.28 g/mol. IUPAC name: 4-(4-methylpiperidin-1-yl)-3-nitrobenzoic acid. InChIKey: UMFDTTHDTBZAGN-UHFFFAOYSA-N.
| Molecular formula | C13H16N2O4 |
|---|---|
| Molecular weight | 264.28 g/mol |
| IUPAC name | 4-(4-methylpiperidin-1-yl)-3-nitrobenzoic acid |
| InChIKey | UMFDTTHDTBZAGN-UHFFFAOYSA-N |
| SMILES | CC1CCN(CC1)C2=C(C=C(C=C2)C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)