tert-Butyl 5-nitrothiophene-2-carboxylate, 95%
cas: 62224-28-6 — see every product listed under this CAS number, including other names
tert-Butyl 5-nitrothiophene-2-carboxylate, 95% (CAS 62224-28-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 5g, 25g, 100mg, 1g. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A790389-250mg |
| cas | 62224-28-6 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 197.94 Pln | |
| Ambeed | 5g | 259.12 Pln | |
| Ambeed | 25g | 626.25 Pln | |
| BLDpharm | 100mg | 186.63 Pln | |
| BLDpharm | 250mg | 208.84 Pln | |
| BLDpharm | 5g | 297.70 Pln | |
| BLDpharm | 25g | 1147.40 Pln | |
| Chemat | 100mg | 93.20 Pln | |
| Chemat | 250mg | 98.00 Pln | |
| Chemat | 1g | 122.00 Pln | |
| Chemat | 5g | 290.00 Pln | |
| Chemat | 25g | 1182.80 Pln | |
| Fluorochem | 5g | 518.59 Pln | |
| Fluorochem | 25g | 2184.66 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
Tert-butyl 5-nitrothiophene-2-carboxylate (CAS 62224-28-6) is a chemical compound with the molecular formula C9H11NO4S and a molecular weight of 229.26 g/mol. IUPAC name: tert-butyl 5-nitrothiophene-2-carboxylate. InChIKey: BEWAPSFNODYQCW-UHFFFAOYSA-N.
| Molecular formula | C9H11NO4S |
|---|---|
| Molecular weight | 229.26 g/mol |
| IUPAC name | tert-butyl 5-nitrothiophene-2-carboxylate |
| InChIKey | BEWAPSFNODYQCW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=CC=C(S1)[N+](=O)[O-] |
Computed by PubChem (NCBI)