tert-Butyl 6,8-dichloro-3,4-dihydro-2,7-naphthyridine-2(1H)-carboxylate, 97%
cas: 1956331-16-0 — see every product listed under this CAS number, including other names
tert-Butyl 6,8-dichloro-3,4-dihydro-2,7-naphthyridine-2(1H)-carboxylate, 97% (CAS 1956331-16-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 50mg, 100mg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A234524-250mg |
| cas | 1956331-16-0 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 1972.38 Pln | |
| Ambeed | 1g | 5181.94 Pln | |
| Ambeed | 5g | 20517.75 Pln | |
| Chemat | 50mg | 501.20 Pln | |
| Chemat | 100mg | 808.40 Pln | |
| Chemat | 250mg | 1326.80 Pln | |
| Chemat | 1g | 4787.60 Pln | |
| Chemat | 5g | 18952.40 Pln | |
| BLDpharm | 50mg | 714.22 Pln | |
| BLDpharm | 100mg | 1169.61 Pln | |
| BLDpharm | 250mg | 1930.46 Pln | |
| BLDpharm | 1g | 5079.35 Pln | |
| BLDpharm | 5g | 20107.39 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
Tert-butyl 6,8-dichloro-3,4-dihydro-1H-2,7-naphthyridine-2-carboxylate (CAS 1956331-16-0) is a chemical compound with the molecular formula C13H16Cl2N2O2 and a molecular weight of 303.18 g/mol. IUPAC name: tert-butyl 6,8-dichloro-3,4-dihydro-1H-2,7-naphthyridine-2-carboxylate. InChIKey: RPJOAXLGRKQAKY-UHFFFAOYSA-N.
| Molecular formula | C13H16Cl2N2O2 |
|---|---|
| Molecular weight | 303.18 g/mol |
| IUPAC name | tert-butyl 6,8-dichloro-3,4-dihydro-1H-2,7-naphthyridine-2-carboxylate |
| InChIKey | RPJOAXLGRKQAKY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2=CC(=NC(=C2C1)Cl)Cl |
Computed by PubChem (NCBI)