cas: 895525-73-2 — see every product listed under this CAS number, including other names
tert-Butyl 6-bromo-4H-spiro[benzo[d][1,3]dioxine-2,4'-piperidine]-1'-carboxylate, 95%, 95% (CAS 895525-73-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114ZNI-250mg |
| cas | 895525-73-2 |
| size | 250mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 1182.80 Pln | |
| Chemat | 1g | 2862.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 6-bromospiro[4H-1,3-benzodioxine-2,4'-piperidine]-1'-carboxylate (CAS 895525-73-2) is a chemical compound with the molecular formula C17H22BrNO4 and a molecular weight of 384.3 g/mol. IUPAC name: tert-butyl 6-bromospiro[4H-1,3-benzodioxine-2,4'-piperidine]-1'-carboxylate. InChIKey: YKOKNSPJTCUZOQ-UHFFFAOYSA-N.
| Molecular formula | C17H22BrNO4 |
|---|---|
| Molecular weight | 384.3 g/mol |
| IUPAC name | tert-butyl 6-bromospiro[4H-1,3-benzodioxine-2,4'-piperidine]-1'-carboxylate |
| InChIKey | YKOKNSPJTCUZOQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CC1)OCC3=C(O2)C=CC(=C3)Br |
Computed by PubChem (NCBI)