tert-Butyl 6-bromopicolinate, 98%
cas: 910044-07-4 — see every product listed under this CAS number, including other names
tert-Butyl 6-bromopicolinate, 98% (CAS 910044-07-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A158343-250mg |
| cas | 910044-07-4 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 203.50 Pln | |
| Ambeed | 1g | 359.25 Pln | |
| Ambeed | 5g | 820.94 Pln | |
| Ambeed | 10g | 1349.38 Pln | |
| Ambeed | 25g | 2628.75 Pln | |
| BLDpharm | 250mg | 214.39 Pln | |
| BLDpharm | 1g | 386.56 Pln | |
| BLDpharm | 5g | 880.83 Pln | |
| BLDpharm | 10g | 1452.85 Pln | |
| BLDpharm | 25g | 2830.14 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
Tert-butyl 6-bromopyridine-2-carboxylate (CAS 910044-07-4) is a chemical compound with the molecular formula C10H12BrNO2 and a molecular weight of 258.11 g/mol. IUPAC name: tert-butyl 6-bromopyridine-2-carboxylate. InChIKey: FMFVWFOLGYTRBX-UHFFFAOYSA-N.
| Molecular formula | C10H12BrNO2 |
|---|---|
| Molecular weight | 258.11 g/mol |
| IUPAC name | tert-butyl 6-bromopyridine-2-carboxylate |
| InChIKey | FMFVWFOLGYTRBX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=NC(=CC=C1)Br |
Computed by PubChem (NCBI)