cas: 1311390-85-8 — see every product listed under this CAS number, including other names
tert-Butyl 6-oxo-2-azabicyclo[2.2.2]octane-2-carboxylate 95% (CAS 1311390-85-8) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A344226-50mg |
| cas | 1311390-85-8 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 487.19 Pln | |
| Ambeed | 100mg | 776.44 Pln | |
| Ambeed | 250mg | 1343.81 Pln | |
| Ambeed | 1g | 3507.62 Pln | |
| Ambeed | 5g | 13814.94 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A344226 |
Tert-butyl 6-oxo-2-azabicyclo[2.2.2]octane-2-carboxylate (CAS 1311390-85-8) is a chemical compound with the molecular formula C12H19NO3 and a molecular weight of 225.28 g/mol. IUPAC name: tert-butyl 6-oxo-2-azabicyclo[2.2.2]octane-2-carboxylate. InChIKey: TZFSRKZPRIJHFU-UHFFFAOYSA-N.
| Molecular formula | C12H19NO3 |
|---|---|
| Molecular weight | 225.28 g/mol |
| IUPAC name | tert-butyl 6-oxo-2-azabicyclo[2.2.2]octane-2-carboxylate |
| InChIKey | TZFSRKZPRIJHFU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2CCC1C(=O)C2 |
Computed by PubChem (NCBI)