cas: 1311390-85-8 — see every product listed under this CAS number, including other names
tert-butyl 6-oxo-2-azabicyclo[2.2.2]octane-2-carboxylate, 95%, 95% (CAS 1311390-85-8) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111VL6-50mg |
| cas | 1311390-85-8 |
| size | 50mg |
| availability | 6g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 462.80 Pln | |
| Chemat | 100mg | 746.00 Pln | |
| Chemat | 250mg | 1067.60 Pln | |
| Chemat | 1g | 3256.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 6-oxo-2-azabicyclo[2.2.2]octane-2-carboxylate (CAS 1311390-85-8) is a chemical compound with the molecular formula C12H19NO3 and a molecular weight of 225.28 g/mol. IUPAC name: tert-butyl 6-oxo-2-azabicyclo[2.2.2]octane-2-carboxylate. InChIKey: TZFSRKZPRIJHFU-UHFFFAOYSA-N.
| Molecular formula | C12H19NO3 |
|---|---|
| Molecular weight | 225.28 g/mol |
| IUPAC name | tert-butyl 6-oxo-2-azabicyclo[2.2.2]octane-2-carboxylate |
| InChIKey | TZFSRKZPRIJHFU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2CCC1C(=O)C2 |
Computed by PubChem (NCBI)