cas: 1993086-20-6 — see every product listed under this CAS number, including other names
tert-Butyl 7-methoxy-2-oxospiro(indoline-3,4'-piperidine)-1'-carboxylate, 95% (CAS 1993086-20-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 250mg. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A209275-1g |
| cas | 1993086-20-6 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 15303.40 Pln | |
| AmBeed | 250mg | 6163.36 Pln |
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
Tert-butyl 7-methoxy-2-oxospiro[1H-indole-3,4'-piperidine]-1'-carboxylate (CAS 1993086-20-6) is a chemical compound with the molecular formula C18H24N2O4 and a molecular weight of 332.4 g/mol. IUPAC name: tert-butyl 7-methoxy-2-oxospiro[1H-indole-3,4'-piperidine]-1'-carboxylate. InChIKey: QEHKGRBWCYXVFP-UHFFFAOYSA-N.
| Molecular formula | C18H24N2O4 |
|---|---|
| Molecular weight | 332.4 g/mol |
| IUPAC name | tert-butyl 7-methoxy-2-oxospiro[1H-indole-3,4'-piperidine]-1'-carboxylate |
| InChIKey | QEHKGRBWCYXVFP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CC1)C3=C(C(=CC=C3)OC)NC2=O |
Computed by PubChem (NCBI)