cas: 911297-03-5 — see every product listed under this CAS number, including other names
tert-Butyl n-(3-chloro-4-hydroxyphenyl)carbamate, 95-<97% (CAS 911297-03-5) is a chemical reagent available from Chemat. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g, 100g. Offered by: Hoffman Fine Chemicals.
| brand | Hoffman Fine Chemicals |
|---|---|
| catalog number | HFC3346-95-97-2.5g |
| cas | 911297-03-5 |
| size | 2,5g |
| availability | 3-4 tygodnie|3-4 weeks |
| brand | size | price | |
|---|---|---|---|
| Hoffman Fine Chemicals | 2,5g | 3478.86 Pln | |
| Hoffman Fine Chemicals | 5g | 5329.06 Pln | |
| Hoffman Fine Chemicals | 10g | 8340.42 Pln | |
| Hoffman Fine Chemicals | 25g | 16372.84 Pln | |
| Hoffman Fine Chemicals | 50g | 26006.64 Pln | |
| Hoffman Fine Chemicals | 100g | 43998.24 Pln |
| purity | 95-<97% |
|---|---|
| category | Chemicals |
| delivery time | 3-4 weeks |
Tert-butyl N-(3-chloro-4-hydroxyphenyl)carbamate (CAS 911297-03-5) is a chemical compound with the molecular formula C11H14ClNO3 and a molecular weight of 243.68 g/mol. IUPAC name: tert-butyl N-(3-chloro-4-hydroxyphenyl)carbamate. InChIKey: HTKIMPSOKVLTQC-UHFFFAOYSA-N.
| Molecular formula | C11H14ClNO3 |
|---|---|
| Molecular weight | 243.68 g/mol |
| IUPAC name | tert-butyl N-(3-chloro-4-hydroxyphenyl)carbamate |
| InChIKey | HTKIMPSOKVLTQC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=CC(=C(C=C1)O)Cl |
Computed by PubChem (NCBI)