cas: 1394003-66-7 — see every product listed under this CAS number, including other names
tert-Butyl pyrazolo[1,5-a]pyrimidin-3-ylcarbamate 95+% (CAS 1394003-66-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A358983-100mg |
| cas | 1394003-66-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 147.88 Pln | |
| Ambeed | 250mg | 264.69 Pln | |
| Ambeed | 1g | 476.06 Pln | |
| Ambeed | 5g | 1727.62 Pln |
| purity | 95+% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A358983 |
Tert-butyl N-pyrazolo[1,5-a]pyrimidin-3-ylcarbamate (CAS 1394003-66-7) is a chemical compound with the molecular formula C11H14N4O2 and a molecular weight of 234.25 g/mol. IUPAC name: tert-butyl N-pyrazolo[1,5-a]pyrimidin-3-ylcarbamate. InChIKey: XEEBWARTSKGTSY-UHFFFAOYSA-N.
| Molecular formula | C11H14N4O2 |
|---|---|
| Molecular weight | 234.25 g/mol |
| IUPAC name | tert-butyl N-pyrazolo[1,5-a]pyrimidin-3-ylcarbamate |
| InChIKey | XEEBWARTSKGTSY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=C2N=CC=CN2N=C1 |
Computed by PubChem (NCBI)