cas: 1188263-72-0 — see every product listed under this CAS number, including other names
tert-Butyl pyrrolidin-3-ylcarbamate hydrochloride, 97%, 97% (CAS 1188263-72-0) is a chemical reagent available from Chemat. Available pack sizes: 25g, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114I7Z-25g |
| cas | 1188263-72-0 |
| size | 25g |
| availability | 35g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25g | 534.80 Pln | |
| Chemat | 1g | 83.60 Pln | |
| Chemat | 5g | 160.40 Pln | |
| Chemat | 10g | 256.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl N-pyrrolidin-3-ylcarbamate;hydrochloride (CAS 1188263-72-0) is a chemical compound with the molecular formula C9H19ClN2O2 and a molecular weight of 222.71 g/mol. IUPAC name: tert-butyl N-pyrrolidin-3-ylcarbamate;hydrochloride. InChIKey: UYIZWZJKNFDMPB-UHFFFAOYSA-N.
| Molecular formula | C9H19ClN2O2 |
|---|---|
| Molecular weight | 222.71 g/mol |
| IUPAC name | tert-butyl N-pyrrolidin-3-ylcarbamate;hydrochloride |
| InChIKey | UYIZWZJKNFDMPB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1CCNC1.Cl |
Computed by PubChem (NCBI)