cas: 7507-48-4 — see every product listed under this CAS number, including other names
tert-Butylhydroquinone diacetate (CAS 7507-48-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F092517-1G |
| cas | 7507-48-4 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 247.85 Pln | |
| Fluorochem | 5g | 924.69 Pln |
| delivery time | 3-4 weeks |
|---|
(4-acetyloxy-3-tert-butylphenyl) acetate (CAS 7507-48-4) is a chemical compound with the molecular formula C14H18O4 and a molecular weight of 250.29 g/mol. IUPAC name: (4-acetyloxy-3-tert-butylphenyl) acetate. InChIKey: SJRALGDWZXRRKL-UHFFFAOYSA-N.
| Molecular formula | C14H18O4 |
|---|---|
| Molecular weight | 250.29 g/mol |
| IUPAC name | (4-acetyloxy-3-tert-butylphenyl) acetate |
| InChIKey | SJRALGDWZXRRKL-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=CC(=C(C=C1)OC(=O)C)C(C)(C)C |
Computed by PubChem (NCBI)