cas: 1860028-24-5 — see every product listed under this CAS number, including other names
tert-butyl 2-(1H-pyrazol-4-yl)pyrrolidine-1-carboxylate, 96% (CAS 1860028-24-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F517302-100MG |
| cas | 1860028-24-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 1013.20 Pln | |
| Fluorochem | 250mg | 1330.80 Pln | |
| Fluorochem | 500mg | 2580.36 Pln | |
| Fluorochem | 1g | 3840.33 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl 2-(1H-pyrazol-4-yl)pyrrolidine-1-carboxylate (CAS 1860028-24-5) is a chemical compound with the molecular formula C12H19N3O2 and a molecular weight of 237.30 g/mol. IUPAC name: tert-butyl 2-(1H-pyrazol-4-yl)pyrrolidine-1-carboxylate. InChIKey: LBNUWTQWUYDRNB-UHFFFAOYSA-N.
| Molecular formula | C12H19N3O2 |
|---|---|
| Molecular weight | 237.30 g/mol |
| IUPAC name | tert-butyl 2-(1H-pyrazol-4-yl)pyrrolidine-1-carboxylate |
| InChIKey | LBNUWTQWUYDRNB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCC1C2=CNN=C2 |
Computed by PubChem (NCBI)