cas: 1801243-44-6 — see every product listed under this CAS number, including other names
tert-butyl 3-[(3,5-dimethoxyphenyl)methyl]azetidine-1-carboxylate, 97% (CAS 1801243-44-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch135TKS-100mg |
| cas | 1801243-44-6 |
| size | 100mg |
| availability | 10g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 640.40 Pln | |
| Chemat | 250mg | 981.20 Pln | |
| Chemat | 500mg | 1581.20 Pln | |
| Chemat | 1g | 2358.80 Pln | |
| Chemat | 5g | 7187.60 Pln | |
| Chemat | 10g | 12174.80 Pln | |
| Fluorochem | 100mg | 1174.60 Pln | |
| Fluorochem | 250mg | 1809.80 Pln | |
| Fluorochem | 500mg | 2944.81 Pln | |
| Fluorochem | 1g | 4366.19 Pln | |
| Fluorochem | 5g | 13113.11 Pln | |
| Fluorochem | 10g | 22240.10 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 3-[(3,5-dimethoxyphenyl)methyl]azetidine-1-carboxylate (CAS 1801243-44-6) is a chemical compound with the molecular formula C17H25NO4 and a molecular weight of 307.4 g/mol. IUPAC name: tert-butyl 3-[(3,5-dimethoxyphenyl)methyl]azetidine-1-carboxylate. InChIKey: XSEYIQHPKLRRPD-UHFFFAOYSA-N.
| Molecular formula | C17H25NO4 |
|---|---|
| Molecular weight | 307.4 g/mol |
| IUPAC name | tert-butyl 3-[(3,5-dimethoxyphenyl)methyl]azetidine-1-carboxylate |
| InChIKey | XSEYIQHPKLRRPD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(C1)CC2=CC(=CC(=C2)OC)OC |
Computed by PubChem (NCBI)