cas: 553630-96-9 — see every product listed under this CAS number, including other names
tert-butyl 4-hydroxy-4-(2-methylphenyl)piperidine-1-carboxylate, 98%, 98% (CAS 553630-96-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DPPB-100mg |
| cas | 553630-96-9 |
| size | 100mg |
| availability | 4g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 98.00 Pln | |
| Chemat | 250mg | 146.00 Pln | |
| Chemat | 1g | 395.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 4-hydroxy-4-(2-methylphenyl)piperidine-1-carboxylate (CAS 553630-96-9) is a chemical compound with the molecular formula C17H25NO3 and a molecular weight of 291.4 g/mol. IUPAC name: tert-butyl 4-hydroxy-4-(2-methylphenyl)piperidine-1-carboxylate. InChIKey: AQIBWZZQWKTCOL-UHFFFAOYSA-N.
| Molecular formula | C17H25NO3 |
|---|---|
| Molecular weight | 291.4 g/mol |
| IUPAC name | tert-butyl 4-hydroxy-4-(2-methylphenyl)piperidine-1-carboxylate |
| InChIKey | AQIBWZZQWKTCOL-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1C2(CCN(CC2)C(=O)OC(C)(C)C)O |
Computed by PubChem (NCBI)