cas: 26568-26-3 — see every product listed under this CAS number, including other names
trans-[2-(4-Fluorophenyl)cyclopropyl]amine Hydrochloride, 95%, 95% (CAS 26568-26-3) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11C3ZU-1g |
| cas | 26568-26-3 |
| size | 1g |
| availability | 133g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 2459.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Trans-(1R,2S)-2-(4-fluorophenyl)cyclopropan-1-amine;hydrochloride (CAS 26568-26-3) is a chemical compound with the molecular formula C9H11ClFN and a molecular weight of 187.64 g/mol. IUPAC name: trans-(1R,2S)-2-(4-fluorophenyl)cyclopropan-1-amine;hydrochloride. InChIKey: ZQPBZLHQLCAFOQ-OULXEKPRSA-N.
| Molecular formula | C9H11ClFN |
|---|---|
| Molecular weight | 187.64 g/mol |
| IUPAC name | trans-(1R,2S)-2-(4-fluorophenyl)cyclopropan-1-amine;hydrochloride |
| InChIKey | ZQPBZLHQLCAFOQ-OULXEKPRSA-N |
| SMILES | C1[C@H]([C@@H]1N)C2=CC=C(C=C2)F.Cl |
Computed by PubChem (NCBI)