cas: 7345-82-6 — see every product listed under this CAS number, including other names
trans-2,3-Dimethoxycinnamic Acid, >98.0%(T) (CAS 7345-82-6) is a chemical reagent available from Chemat. Available pack sizes: 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | D2326-25G |
| cas | 7345-82-6 |
| size | 25g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 25g | 1209.97 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(T) |
(E)-3-(2,3-dimethoxyphenyl)prop-2-enoic acid (CAS 7345-82-6) is a chemical compound with the molecular formula C11H12O4 and a molecular weight of 208.21 g/mol. IUPAC name: (E)-3-(2,3-dimethoxyphenyl)prop-2-enoic acid. InChIKey: QAXPUWGAGVERSJ-VOTSOKGWSA-N.
| Molecular formula | C11H12O4 |
|---|---|
| Molecular weight | 208.21 g/mol |
| IUPAC name | (E)-3-(2,3-dimethoxyphenyl)prop-2-enoic acid |
| InChIKey | QAXPUWGAGVERSJ-VOTSOKGWSA-N |
| SMILES | COC1=CC=CC(=C1OC)/C=C/C(=O)O |
Computed by PubChem (NCBI)